摘要:
A fluorine-containing polymer comprising a fluoroalkyl alcohol (meth)acrylic acid derivative represented by a general formula, CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCOCR═CH2 (in the formula, R is a hydrogen atom or a methyl group, n is an integer of 1 to 6, preferably 2 to 4, a is an integer of 1 to 4, b is an integer of 0 to 3, and c is an integer of 1 to 3) containing in 5 to 100 wt % as a polymerization unit. A organic solvent solution or aqueous dispersion of the fluorine-containing polymer is effectively used as, for example, a surface-modifying agent such as a water- and oil-repellent or an oil barrier.
摘要:
A fluorine-containing polymer comprising a fluoroalkyl alcohol (meth)acrylic acid derivative represented by a general formula, CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCOCR═CH2 (in the formula, R is a hydrogen atom or a methyl group, n is an integer of 1 to 6, preferably 2 to 4, a is an integer of 1 to 4, b is an integer of 0 to 3, and c is an integer of 1 to 3) containing in 5 to 100 wt % as a polymerization unit. A organic solvent solution or aqueous dispersion of the fluorine-containing polymer is effectively used as, for example, a surface-modifying agent such as a water- and oil-repellent or an oil barrier.
摘要:
A water- and oil-repellent includes, as an active ingredient, a fluorine-containing copolymer including as a copolymer unit (A) at least one of perfluoroalkylalkyl acrylates and corresponding methacrylates, (B) benzyl acrylate or benzyl methacrylate represented by the general formula: CnF2n+1CmH2mOCOCR═CH2 (wherein R represents a hydrogen atom or a methyl group; n represents 4, 5, or 6; and m represents 1, 2, 3, or 4), (C) a fluorine-free polymerizable monomer other than benzyl acrylate and benzyl methacrylate, and (D) a cross-linkable group-containing polymerizable monomer.
摘要:
A water- and oil-repellent includes, as an active ingredient, a fluorine-containing copolymer including as a copolymer unit (A) at least one of perfluoroalkylalkyl acrylates and corresponding methacrylates, (B) benzyl acrylate or benzyl methacrylate represented by the general formula: CnF2n+1CmH2mOCOCR═CH2 (wherein R represents a hydrogen atom or a methyl group; n represents 4, 5, or 6; and m represents 1, 2, 3, or 4), (C) a fluorine-free polymerizable monomer other than benzyl acrylate and benzyl methacrylate, and (D) a cross-linkable group-containing polymerizable monomer.
摘要:
A water- and oil-repellent includes, as an active ingredient, a fluorine-containing copolymer including as a copolymer unit (A) at least one of perfluoroalkylalkyl acrylates and corresponding methacrylates, (B) benzyl acrylate or benzyl methacrylate represented by the general formula: CnF2n+1CmH2mOCOCR═CH2 (wherein R represents a hydrogen atom or a methyl group; n represents 4, 5, or 6; and m represents 1, 2, 3, or 4), (C) a fluorine-free polymerizable monomer other than benzyl acrylate and benzyl methacrylate, and (D) a cross-linkable group-containing polymerizable monomer.
摘要:
Disclosed is (1) a mixture of fluoroalkyl alcohol-unsaturated carboxylic acid derivatives represented by the general formulae: CF3(CF2)n(CH═CF)a(CF2CF2)b(CH2CH2)c OCOCR═CH2 and CF3(CF2)n−1(CF═CH)a CF2(CF2CF2)b(CH2CH2)cOCOCR═CH2, wherein R is a hydrogen atom or a methyl group, n is an integer of 1 to 5, a is an integer of 1 to 4, b is an integer of 0 to 3, and c is an integer of 1 to 3; (2) a fluorine-containing polymer containing the mixture as a polymerization unit; and (3) a water- and oil-repellent comprising the fluorine-containing polymer as an active ingredient. The fluoroalkyl alcohol-unsaturated carboxylic acid derivatives are produced by an esterification reaction of a mixture of fluoroalkyl alcohols represented by the general formulae: CF3(CF2)n(CH═CF)a(CF2CF2)b(CH2CH2)cOH and CF3(CF2)n−1(CF═CH)aCF2(CF2CF2)b, (CH2CH2)cOH, with acrylic acid or methacrylic acid.
摘要:
Disclosed is (1) a mixture of fluoroalkyl alcohol-unsaturated carboxylic acid derivatives represented by the general formulae: CF3(CF2)n(CH═CF)a(CF2CF2)b(CH2CH2)c OCOCR═CH2 and CF3(CF2)n−1(CF═CH)a CF2(CF2CF2)b(CH2CH2)cOCOCR═CH2, wherein R is a hydrogen atom or a methyl group, n is an integer of 1 to 5, a is an integer of 1 to 4, b is an integer of 0 to 3, and c is an integer of 1 to 3; (2) a fluorine-containing polymer containing the mixture as a polymerization unit; and (3) a water- and oil-repellent comprising the fluorine-containing polymer as an active ingredient. The fluoroalkyl alcohol-unsaturated carboxylic acid derivatives are produced by an esterification reaction of a mixture of fluoroalkyl alcohols represented by the general formulae: CF3(CF2)n(CH═CF)a(CF2CF2)b(CH2CH2)cOH and CF3(CF2)n−1(CF═CH)aCF2(CF2CF2)b, (CH2CH2)cOH, with acrylic acid or methacrylic acid.
摘要:
A terminally iodized polyfluoroalkane oligomer represented by the following general formula: CnF2n+1(CH2CF2)s+p(CF2CF2)t+rI [I] (wherein n is an integer of 1 to 6, s+p is an integer of 1 to 4, showing the number of vinylidene fluoride skeleton, and t+r is an integer of 1 to 6, showing the number of tetrafluoroethylene skeleton, the adjacent group to the CnF2n+1 group being the CH2CF2 group) can be produced by reaction of a terminally iodized polyfluoroalkane, represented by the following general formula: CnF2n+1(CH2CF2)s+p(CF2CF2)tI with tetrafluoroethylene in the presence of a peroxide initiator.
摘要:
A polyfluoroalkyl alcohol, or a (meth)acrylic acid derivative thereof, represented by the following general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOR (R:H or (meth)acrylic acid group; n: 1-6; a: 1-4; b: 1-3; and c: 1-3). Polyfluoroalkyl alcohol (R: hydrogen atom) can be produced by reaction of fluoroalkyl iodide represented by the following general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cI with N-methyl formamide, followed by hydrolysis in the presence of an acid catalyst, whereas polyfluoroalkyl alcohol (meth)acrylic acid derivative (R: (meth)acrylic acid group) can be produced by reaction of the polyfluoroalkyl alcohol with (meth)acrylic acid.
摘要:
A polyfluoroalkyl alcohol, or a (meth)acrylic acid derivative thereof, represented by the following general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOR (R:H or (meth)acrylic acid group; n: 1-6; a: 1-4; b: 1-3; and c: 1-3). Polyfluoroalkyl alcohol (R: hydrogen atom) can be produced by reaction of fluoroalkyl iodide represented by the following general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cI with N-methyl formamide, followed by hydrolysis in the presence of an acid catalyst, whereas polyfluoroalkyl alcohol (meth)acrylic acid derivative (R: (meth)acrylic acid group) can be produced by reaction of the polyfluoroalkyl alcohol with (meth)acrylic acid.